C13H20F3N3O — CID 142510750
N-(2-aminoethyl)-3-(trifluoromethyl)benzamide;propan-1-amine (PubChem CID 142510750) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-(trifluoromethyl)benzamide;propan-1-amine.
| Compound Name | N-(2-aminoethyl)-3-(trifluoromethyl)benzamide;propan-1-amine |
|---|---|
| PubChem CID | 142510750 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(2-aminoethyl)-3-(trifluoromethyl)benzamide;propan-1-amine |
| SMILES | CCCN.NCCNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F3N2O.C3H9N/c11-10(12,13)8-3-1-2-7(6-8)9(16)15-5-4-14;1-2-3-4/h1-3,6H,4-5,14H2,(H,15,16);2-4H2,1H3 |
| InChIKey | HFEOASNRWRXNHE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |