C13H17F3N2O2 — CID 106307969
N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)benzamide (PubChem CID 106307969) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 106307969 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-3-(trifluoromethyl)benzamide |
| SMILES | NCCOCCCNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-13(15,16)11-4-1-3-10(9-11)12(19)18-6-2-7-20-8-5-17/h1,3-4,9H,2,5-8,17H2,(H,18,19) |
| InChIKey | UAYOEBXSRWHDCA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|