C13H18F3N3O2 — CID 106308105
1-[3-(2-aminoethoxy)propyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 106308105) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[3-(2-aminoethoxy)propyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(2-aminoethoxy)propyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 106308105 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[3-(2-aminoethoxy)propyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | NCCOCCCNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3N3O2/c14-13(15,16)10-2-4-11(5-3-10)19-12(20)18-7-1-8-21-9-6-17/h2-5H,1,6-9,17H2,(H2,18,19,20) |
| InChIKey | WBHRDZLTAUDIHP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|