C11H12F3N3O2 — CID 43315998
N-(2-aminoethyl)-N'-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 43315998) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 43315998 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(2-aminoethyl)-N'-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | NCCNC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)7-1-3-8(4-2-7)17-10(19)9(18)16-6-5-15/h1-4H,5-6,15H2,(H,16,18)(H,17,19) |
| InChIKey | BUOJGSVTBZFGTO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|