C11H15N3O2 — CID 43315800
N-(2-aminoethyl)-N'-(4-methylphenyl)oxamide (PubChem CID 43315800) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(4-methylphenyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 43315800 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(2-aminoethyl)-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCCN)cc1 |
| InChI | InChI=1S/C11H15N3O2/c1-8-2-4-9(5-3-8)14-11(16)10(15)13-7-6-12/h2-5H,6-7,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | AQWSAXUEGIYNBH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|