C12H16N4O3 — CID 43316047
N'-(3-acetamidophenyl)-N-(2-aminoethyl)oxamide (PubChem CID 43316047) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-(2-aminoethyl)oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-(2-aminoethyl)oxamide |
|---|---|
| PubChem CID | 43316047 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-(2-aminoethyl)oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCCN)c1 |
| InChI | InChI=1S/C12H16N4O3/c1-8(17)15-9-3-2-4-10(7-9)16-12(19)11(18)14-6-5-13/h2-4,7H,5-6,13H2,1H3,(H,14,18)(H,15,17)(H,16,19) |
| InChIKey | YGAMQHCDLKLALI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|