C16H17N3O4 — CID 7584781
N'-(3-acetamidophenyl)-N-[2-(furan-2-yl)ethyl]oxamide (PubChem CID 7584781) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-[2-(furan-2-yl)ethyl]oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-[2-(furan-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 7584781 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-[2-(furan-2-yl)ethyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCCc2ccco2)c1 |
| InChI | InChI=1S/C16H17N3O4/c1-11(20)18-12-4-2-5-13(10-12)19-16(22)15(21)17-8-7-14-6-3-9-23-14/h2-6,9-10H,7-8H2,1H3,(H,17,21)(H,18,20)(H,19,22) |
| InChIKey | DNUCMCPYBIPHFI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|