C13H11BrN2O3 — CID 47224195
N'-(3-bromophenyl)-N-(furan-2-ylmethyl)oxamide (PubChem CID 47224195) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-(3-bromophenyl)-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 47224195 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N'-(3-bromophenyl)-N-(furan-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccco1)C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C13H11BrN2O3/c14-9-3-1-4-10(7-9)16-13(18)12(17)15-8-11-5-2-6-19-11/h1-7H,8H2,(H,15,17)(H,16,18) |
| InChIKey | PWBPNAYGBHAEHE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|