C18H20N4O4 — CID 3101332
N'-[[4-(furan-2-ylmethylamino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide (PubChem CID 3101332) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N'-[[4-(furan-2-ylmethylamino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide.
| Compound Name | N'-[[4-(furan-2-ylmethylamino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 3101332 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N'-[[4-(furan-2-ylmethylamino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide |
| SMILES | CC(CC(=O)NCc1ccco1)=NNC(=O)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-12-5-3-6-14(9-12)20-17(24)18(25)22-21-13(2)10-16(23)19-11-15-7-4-8-26-15/h3-9H,10-11H2,1-2H3,(H,19,23)(H,20,24)(H,22,25) |
| InChIKey | LPNOMTDDVKXOSA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|