C19H18Cl2N4O3 — CID 51064207
N'-[(E)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide (PubChem CID 51064207) has the molecular formula C19H18Cl2N4O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is N'-[(E)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide.
| Compound Name | N'-[(E)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 51064207 |
| Molecular Formula | C19H18Cl2N4O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N'-[(E)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-N-(3-methylphenyl)oxamide |
| SMILES | C/C(CC(=O)Nc1ccc(Cl)c(Cl)c1)=N\NC(=O)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C19H18Cl2N4O3/c1-11-4-3-5-13(8-11)23-18(27)19(28)25-24-12(2)9-17(26)22-14-6-7-15(20)16(21)10-14/h3-8,10H,9H2,1-2H3,(H,22,26)(H,23,27)(H,25,28)/b24-12+ |
| InChIKey | ZYTZJXXTYTVYFZ-WYMPLXKRSA-N |
| XLogP | 3.76 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|