C20H20ClN5O4 — CID 46501220
N'-[(E)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-2-methylphenyl)oxamide (PubChem CID 46501220) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is N'-[(E)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-2-methylphenyl)oxamide.
| Compound Name | N'-[(E)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 46501220 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N'-[(E)-[4-(4-carbamoylanilino)-4-oxobutan-2-ylidene]amino]-N-(3-chloro-2-methylphenyl)oxamide |
| SMILES | C/C(CC(=O)Nc1ccc(C(N)=O)cc1)=N\NC(=O)C(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C20H20ClN5O4/c1-11(10-17(27)23-14-8-6-13(7-9-14)18(22)28)25-26-20(30)19(29)24-16-5-3-4-15(21)12(16)2/h3-9H,10H2,1-2H3,(H2,22,28)(H,23,27)(H,24,29)(H,26,30)/b25-11+ |
| InChIKey | GDFNDSLEXZGSTO-OPEKNORGSA-N |
| XLogP | 2.21 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|