C20H21N5O4 — CID 6259574
N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-phenyloxamide (PubChem CID 6259574) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-phenyloxamide.
| Compound Name | N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-phenyloxamide |
|---|---|
| PubChem CID | 6259574 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-phenyloxamide |
| SMILES | CC(=O)Nc1ccccc1NC(=O)C/C(C)=N\NC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H21N5O4/c1-13(24-25-20(29)19(28)22-15-8-4-3-5-9-15)12-18(27)23-17-11-7-6-10-16(17)21-14(2)26/h3-11H,12H2,1-2H3,(H,21,26)(H,22,28)(H,23,27)(H,25,29)/b24-13- |
| InChIKey | QWZWCZPBVWWZJG-CFRMEGHHSA-N |
| XLogP | 2.10 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|