C18H20N4O3S — CID 6298048
(3Z)-N-(2-acetamidophenyl)-3-[(2-thiophen-2-ylacetyl)hydrazinylidene]butanamide (PubChem CID 6298048) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is (3Z)-N-(2-acetamidophenyl)-3-[(2-thiophen-2-ylacetyl)hydrazinylidene]butanamide.
| Compound Name | (3Z)-N-(2-acetamidophenyl)-3-[(2-thiophen-2-ylacetyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 6298048 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (3Z)-N-(2-acetamidophenyl)-3-[(2-thiophen-2-ylacetyl)hydrazinylidene]butanamide |
| SMILES | CC(=O)Nc1ccccc1NC(=O)C/C(C)=N\NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C18H20N4O3S/c1-12(21-22-18(25)11-14-6-5-9-26-14)10-17(24)20-16-8-4-3-7-15(16)19-13(2)23/h3-9H,10-11H2,1-2H3,(H,19,23)(H,20,24)(H,22,25)/b21-12- |
| InChIKey | KROOYQLFJHYMJI-MTJSOVHGSA-N |
| XLogP | 2.77 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|