C20H18N2OS — CID 7462993
N-[(E)-1-(4-phenylphenyl)ethylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 7462993) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[(E)-1-(4-phenylphenyl)ethylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(E)-1-(4-phenylphenyl)ethylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 7462993 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[(E)-1-(4-phenylphenyl)ethylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | C/C(=N\NC(=O)Cc1cccs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2OS/c1-15(21-22-20(23)14-19-8-5-13-24-19)16-9-11-18(12-10-16)17-6-3-2-4-7-17/h2-13H,14H2,1H3,(H,22,23)/b21-15+ |
| InChIKey | BNGQSZNVQIYEGK-RCCKNPSSSA-N |
| XLogP | 4.50 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|