C20H24N2O — CID 3111304
N-[1-(4-phenylphenyl)ethylideneamino]hexanamide (PubChem CID 3111304) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[1-(4-phenylphenyl)ethylideneamino]hexanamide.
| Compound Name | N-[1-(4-phenylphenyl)ethylideneamino]hexanamide |
|---|---|
| PubChem CID | 3111304 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[1-(4-phenylphenyl)ethylideneamino]hexanamide |
| SMILES | CCCCCC(=O)NN=C(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-3-4-6-11-20(23)22-21-16(2)17-12-14-19(15-13-17)18-9-7-5-8-10-18/h5,7-10,12-15H,3-4,6,11H2,1-2H3,(H,22,23) |
| InChIKey | ZSBUOVLQIAWKBG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|