C22H33N3O4 — CID 6155679
5-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]anilino]-5-oxopentanoic acid (PubChem CID 6155679) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 5-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6155679 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 5-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]anilino]-5-oxopentanoic acid |
| SMILES | CCCCCCCCC(=O)N/N=C(\C)c1ccc(NC(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C22H33N3O4/c1-3-4-5-6-7-8-10-21(27)25-24-17(2)18-13-15-19(16-14-18)23-20(26)11-9-12-22(28)29/h13-16H,3-12H2,1-2H3,(H,23,26)(H,25,27)(H,28,29)/b24-17+ |
| InChIKey | TXEJUVUXSRDJTH-JJIBRWJFSA-N |
| XLogP | 4.47 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|