C17H22F3N3O2 — CID 6379660
N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]heptanamide (PubChem CID 6379660) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]heptanamide.
| Compound Name | N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]heptanamide |
|---|---|
| PubChem CID | 6379660 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]heptanamide |
| SMILES | CCCCCCC(=O)N/N=C(/C)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-3-4-5-6-7-15(24)23-22-12(2)13-8-10-14(11-9-13)21-16(25)17(18,19)20/h8-11H,3-7H2,1-2H3,(H,21,25)(H,23,24)/b22-12- |
| InChIKey | FGOILBRREVFWOP-UUYOSTAYSA-N |
| XLogP | 4.00 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|