C21H31N3O2 — CID 6165307
N-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]phenyl]cyclopropanecarboxamide (PubChem CID 6165307) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 6165307 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[4-[(E)-C-methyl-N-(nonanoylamino)carbonimidoyl]phenyl]cyclopropanecarboxamide |
| SMILES | CCCCCCCCC(=O)N/N=C(\C)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-3-4-5-6-7-8-9-20(25)24-23-16(2)17-12-14-19(15-13-17)22-21(26)18-10-11-18/h12-15,18H,3-11H2,1-2H3,(H,22,26)(H,24,25)/b23-16+ |
| InChIKey | HRDMFDHWQNLOAH-XQNSMLJCSA-N |
| XLogP | 4.63 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|