C34H44N6O4 — CID 3344683
N,N'-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]butanediamide (PubChem CID 3344683) has the molecular formula C34H44N6O4 and a molecular weight of 600.76 g/mol. Its IUPAC name is N,N'-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]butanediamide.
| Compound Name | N,N'-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 3344683 |
| Molecular Formula | C34H44N6O4 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | N,N'-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)NN=C(C)c1ccc(NC(=O)C2CCCCC2)cc1)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C34H44N6O4/c1-23(25-13-17-29(18-14-25)35-33(43)27-9-5-3-6-10-27)37-39-31(41)21-22-32(42)40-38-24(2)26-15-19-30(20-16-26)36-34(44)28-11-7-4-8-12-28/h13-20,27-28H,3-12,21-22H2,1-2H3,(H,35,43)(H,36,44)(H,39,41)(H,40,42) |
| InChIKey | BILYPHXWMGCVIM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|