C38H44N6O4 — CID 3422993
1-N,4-N-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]benzene-1,4-dicarboxamide (PubChem CID 3422993) has the molecular formula C38H44N6O4 and a molecular weight of 648.81 g/mol. Its IUPAC name is 1-N,4-N-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3422993 |
| Molecular Formula | C38H44N6O4 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | 1-N,4-N-bis[1-[4-(cyclohexanecarbonylamino)phenyl]ethylideneamino]benzene-1,4-dicarboxamide |
| SMILES | CC(=NNC(=O)c1ccc(C(=O)NN=C(C)c2ccc(NC(=O)C3CCCCC3)cc2)cc1)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C38H44N6O4/c1-25(27-17-21-33(22-18-27)39-35(45)29-9-5-3-6-10-29)41-43-37(47)31-13-15-32(16-14-31)38(48)44-42-26(2)28-19-23-34(24-20-28)40-36(46)30-11-7-4-8-12-30/h13-24,29-30H,3-12H2,1-2H3,(H,39,45)(H,40,46)(H,43,47)(H,44,48) |
| InChIKey | RKESTYZMCQKMAO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|