C38H52N6O4 — CID 4578021
N,N'-bis[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]octanediamide (PubChem CID 4578021) has the molecular formula C38H52N6O4 and a molecular weight of 656.87 g/mol. Its IUPAC name is N,N'-bis[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 4578021 |
| Molecular Formula | C38H52N6O4 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | N,N'-bis[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]octanediamide |
| SMILES | CC(=NNC(=O)CCCCCCC(=O)NN=C(C)c1cccc(NC(=O)C2CCCCC2)c1)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C38H52N6O4/c1-27(31-19-13-21-33(25-31)39-37(47)29-15-7-5-8-16-29)41-43-35(45)23-11-3-4-12-24-36(46)44-42-28(2)32-20-14-22-34(26-32)40-38(48)30-17-9-6-10-18-30/h13-14,19-22,25-26,29-30H,3-12,15-18,23-24H2,1-2H3,(H,39,47)(H,40,48)(H,43,45)(H,44,46) |
| InChIKey | VYFSAVUWFOMDRE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|