C17H22N4O3 — CID 3771938
N'-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]oxamide (PubChem CID 3771938) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]oxamide.
| Compound Name | N'-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 3771938 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N'-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]oxamide |
| SMILES | CC(=NNC(=O)C(N)=O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H22N4O3/c1-11(20-21-17(24)15(18)22)13-8-5-9-14(10-13)19-16(23)12-6-3-2-4-7-12/h5,8-10,12H,2-4,6-7H2,1H3,(H2,18,22)(H,19,23)(H,21,24) |
| InChIKey | MKTAXUZMSGURQV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|