C23H26ClN3O3 — CID 3362887
5-chloro-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-2-methoxybenzamide (PubChem CID 3362887) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 5-chloro-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3362887 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 5-chloro-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NN=C(C)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-15(26-27-23(29)20-14-18(24)11-12-21(20)30-2)17-9-6-10-19(13-17)25-22(28)16-7-4-3-5-8-16/h6,9-14,16H,3-5,7-8H2,1-2H3,(H,25,28)(H,27,29) |
| InChIKey | HPMUBKIVYMFBRN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|