C20H22BrN3O3 — CID 4105302
5-bromo-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]furan-2-carboxamide (PubChem CID 4105302) has the molecular formula C20H22BrN3O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is 5-bromo-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 4105302 |
| Molecular Formula | C20H22BrN3O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 5-bromo-N-[1-[3-(cyclohexanecarbonylamino)phenyl]ethylideneamino]furan-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(Br)o1)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H22BrN3O3/c1-13(23-24-20(26)17-10-11-18(21)27-17)15-8-5-9-16(12-15)22-19(25)14-6-3-2-4-7-14/h5,8-12,14H,2-4,6-7H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | JSBGAHMMXLRREX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|