C18H21Br2N3O2 — CID 129439535
N-[3-[N-[[(1S)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]cyclobutanecarboxamide (PubChem CID 129439535) has the molecular formula C18H21Br2N3O2 and a molecular weight of 471.19 g/mol. Its IUPAC name is N-[3-[N-[[(1S)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[N-[[(1S)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 129439535 |
| Molecular Formula | C18H21Br2N3O2 |
| Molecular Weight | 471.19 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | N-[3-[N-[[(1S)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]-C-methylcarbonimidoyl]phenyl]cyclobutanecarboxamide |
| SMILES | CC(=NNC(=O)[C@]1(C)CC1(Br)Br)c1cccc(NC(=O)C2CCC2)c1 |
| InChI | InChI=1S/C18H21Br2N3O2/c1-11(22-23-16(25)17(2)10-18(17,19)20)13-7-4-8-14(9-13)21-15(24)12-5-3-6-12/h4,7-9,12H,3,5-6,10H2,1-2H3,(H,21,24)(H,23,25)/t17-/m0/s1 |
| InChIKey | MSUYICCOBYEYGQ-KRWDZBQOSA-N |
| XLogP | 4.16 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|