C23H24Cl3N3O3 — CID 4147902
N-[4-[C-methyl-N-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclohexanecarboxamide (PubChem CID 4147902) has the molecular formula C23H24Cl3N3O3 and a molecular weight of 496.82 g/mol. Its IUPAC name is N-[4-[C-methyl-N-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[C-methyl-N-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4147902 |
| Molecular Formula | C23H24Cl3N3O3 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[4-[C-methyl-N-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclohexanecarboxamide |
| SMILES | CC(=NNC(=O)COc1cc(Cl)c(Cl)cc1Cl)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H24Cl3N3O3/c1-14(28-29-22(30)13-32-21-12-19(25)18(24)11-20(21)26)15-7-9-17(10-8-15)27-23(31)16-5-3-2-4-6-16/h7-12,16H,2-6,13H2,1H3,(H,27,31)(H,29,30) |
| InChIKey | NSCYAOZEXQQANG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|