C25H24F6N6O4 — CID 3899858
N,N'-bis[1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pentanediamide (PubChem CID 3899858) has the molecular formula C25H24F6N6O4 and a molecular weight of 586.49 g/mol. Its IUPAC name is N,N'-bis[1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pentanediamide.
| Compound Name | N,N'-bis[1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pentanediamide |
|---|---|
| PubChem CID | 3899858 |
| Molecular Formula | C25H24F6N6O4 |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | N,N'-bis[1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]pentanediamide |
| SMILES | CC(=NNC(=O)CCCC(=O)NN=C(C)c1cccc(NC(=O)C(F)(F)F)c1)c1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F6N6O4/c1-14(16-6-3-8-18(12-16)32-22(40)24(26,27)28)34-36-20(38)10-5-11-21(39)37-35-15(2)17-7-4-9-19(13-17)33-23(41)25(29,30)31/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,32,40)(H,33,41)(H,36,38)(H,37,39) |
| InChIKey | DENXMDPNXIEBCH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|