C31H30N6O6 — CID 3545367
N,N'-bis[1-[3-(furan-2-carbonylamino)phenyl]ethylideneamino]pentanediamide (PubChem CID 3545367) has the molecular formula C31H30N6O6 and a molecular weight of 582.62 g/mol. Its IUPAC name is N,N'-bis[1-[3-(furan-2-carbonylamino)phenyl]ethylideneamino]pentanediamide.
| Compound Name | N,N'-bis[1-[3-(furan-2-carbonylamino)phenyl]ethylideneamino]pentanediamide |
|---|---|
| PubChem CID | 3545367 |
| Molecular Formula | C31H30N6O6 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | N,N'-bis[1-[3-(furan-2-carbonylamino)phenyl]ethylideneamino]pentanediamide |
| SMILES | CC(=NNC(=O)CCCC(=O)NN=C(C)c1cccc(NC(=O)c2ccco2)c1)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C31H30N6O6/c1-20(22-8-3-10-24(18-22)32-30(40)26-12-6-16-42-26)34-36-28(38)14-5-15-29(39)37-35-21(2)23-9-4-11-25(19-23)33-31(41)27-13-7-17-43-27/h3-4,6-13,16-19H,5,14-15H2,1-2H3,(H,32,40)(H,33,41)(H,36,38)(H,37,39) |
| InChIKey | KLXPVTOTFUFSEM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 167.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|