C18H19N3O5 — CID 7261370
5-[4-[(E)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]anilino]-5-oxopentanoic acid (PubChem CID 7261370) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-[4-[(E)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]anilino]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(E)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]anilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 7261370 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-[4-[(E)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]anilino]-5-oxopentanoic acid |
| SMILES | C/C(=N\NC(=O)c1ccco1)c1ccc(NC(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C18H19N3O5/c1-12(20-21-18(25)15-4-3-11-26-15)13-7-9-14(10-8-13)19-16(22)5-2-6-17(23)24/h3-4,7-11H,2,5-6H2,1H3,(H,19,22)(H,21,25)(H,23,24)/b20-12+ |
| InChIKey | FCNWZIMYCAMOQT-UDWIEESQSA-N |
| XLogP | 2.63 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|