C15H12F3N3O3 — CID 840435
N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]furan-2-carboxamide (PubChem CID 840435) has the molecular formula C15H12F3N3O3 and a molecular weight of 339.27 g/mol. Its IUPAC name is N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 840435 |
| Molecular Formula | C15H12F3N3O3 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]furan-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccco1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3N3O3/c1-9(20-21-13(22)12-3-2-8-24-12)10-4-6-11(7-5-10)19-14(23)15(16,17)18/h2-8H,1H3,(H,19,23)(H,21,22) |
| InChIKey | YSKCMFKMMQTNNQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|