C21H22F3N3O2 — CID 4061369
4-tert-butyl-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide (PubChem CID 4061369) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 4061369 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-tert-butyl-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(C(C)(C)C)cc1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-13(14-7-11-17(12-8-14)25-19(29)21(22,23)24)26-27-18(28)15-5-9-16(10-6-15)20(2,3)4/h5-12H,1-4H3,(H,25,29)(H,27,28) |
| InChIKey | FGAVIBPVOCQCJK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|