C18H16F3N3O3 — CID 6084116
2-methoxy-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide (PubChem CID 6084116) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is 2-methoxy-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 2-methoxy-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6084116 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-methoxy-N-[(Z)-1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
| SMILES | COc1ccccc1C(=O)N/N=C(/C)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3N3O3/c1-11(23-24-16(25)14-5-3-4-6-15(14)27-2)12-7-9-13(10-8-12)22-17(26)18(19,20)21/h3-10H,1-2H3,(H,22,26)(H,24,25)/b23-11- |
| InChIKey | ZHRKQUSCTIVRGV-KSEXSDGBSA-N |
| XLogP | 3.35 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|