C17H13BrF3N3O2 — CID 3413334
4-bromo-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide (PubChem CID 3413334) has the molecular formula C17H13BrF3N3O2 and a molecular weight of 428.21 g/mol. Its IUPAC name is 4-bromo-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 4-bromo-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3413334 |
| Molecular Formula | C17H13BrF3N3O2 |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 4-bromo-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(Br)cc1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13BrF3N3O2/c1-10(23-24-15(25)12-2-6-13(18)7-3-12)11-4-8-14(9-5-11)22-16(26)17(19,20)21/h2-9H,1H3,(H,22,26)(H,24,25) |
| InChIKey | IMBFUSTXSKLRIO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|