C17H13F3N4O4 — CID 4194720
4-nitro-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide (PubChem CID 4194720) has the molecular formula C17H13F3N4O4 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-nitro-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide.
| Compound Name | 4-nitro-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 4194720 |
| Molecular Formula | C17H13F3N4O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-nitro-N-[1-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N4O4/c1-10(11-2-6-13(7-3-11)21-16(26)17(18,19)20)22-23-15(25)12-4-8-14(9-5-12)24(27)28/h2-9H,1H3,(H,21,26)(H,23,25) |
| InChIKey | ONGKYMQTLCEPPO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|