C18H15F3N4O4 — CID 7114942
2,2,2-trifluoro-N-[4-[(E)-C-methyl-N-[[2-(4-nitrophenyl)acetyl]amino]carbonimidoyl]phenyl]acetamide (PubChem CID 7114942) has the molecular formula C18H15F3N4O4 and a molecular weight of 408.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[(E)-C-methyl-N-[[2-(4-nitrophenyl)acetyl]amino]carbonimidoyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[(E)-C-methyl-N-[[2-(4-nitrophenyl)acetyl]amino]carbonimidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 7114942 |
| Molecular Formula | C18H15F3N4O4 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[(E)-C-methyl-N-[[2-(4-nitrophenyl)acetyl]amino]carbonimidoyl]phenyl]acetamide |
| SMILES | C/C(=N\NC(=O)Cc1ccc([N+](=O)[O-])cc1)c1ccc(NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N4O4/c1-11(13-4-6-14(7-5-13)22-17(27)18(19,20)21)23-24-16(26)10-12-2-8-15(9-3-12)25(28)29/h2-9H,10H2,1H3,(H,22,27)(H,24,26)/b23-11+ |
| InChIKey | XAFXVHUXHODXCG-FOKLQQMPSA-N |
| XLogP | 3.18 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|