C26H32N6O6 — CID 4631654
N,N'-bis[1-(4-nitrophenyl)ethylideneamino]decanediamide (PubChem CID 4631654) has the molecular formula C26H32N6O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is N,N'-bis[1-(4-nitrophenyl)ethylideneamino]decanediamide.
| Compound Name | N,N'-bis[1-(4-nitrophenyl)ethylideneamino]decanediamide |
|---|---|
| PubChem CID | 4631654 |
| Molecular Formula | C26H32N6O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N,N'-bis[1-(4-nitrophenyl)ethylideneamino]decanediamide |
| SMILES | CC(=NNC(=O)CCCCCCCCC(=O)NN=C(C)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H32N6O6/c1-19(21-11-15-23(16-12-21)31(35)36)27-29-25(33)9-7-5-3-4-6-8-10-26(34)30-28-20(2)22-13-17-24(18-14-22)32(37)38/h11-18H,3-10H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | SZABNHPDUIIVRE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|