C24H32N6O2 — CID 4586480
N,N'-bis[1-(4-aminophenyl)ethylideneamino]octanediamide (PubChem CID 4586480) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N,N'-bis[1-(4-aminophenyl)ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-(4-aminophenyl)ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 4586480 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N,N'-bis[1-(4-aminophenyl)ethylideneamino]octanediamide |
| SMILES | CC(=NNC(=O)CCCCCCC(=O)NN=C(C)c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-17(19-9-13-21(25)14-10-19)27-29-23(31)7-5-3-4-6-8-24(32)30-28-18(2)20-11-15-22(26)16-12-20/h9-16H,3-8,25-26H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | QIZOQGMPGBYMOK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|