C26H34N4O4 — CID 3411990
N,N'-bis[1-(4-methoxyphenyl)ethylideneamino]octanediamide (PubChem CID 3411990) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is N,N'-bis[1-(4-methoxyphenyl)ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-(4-methoxyphenyl)ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 3411990 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | N,N'-bis[1-(4-methoxyphenyl)ethylideneamino]octanediamide |
| SMILES | COc1ccc(C(C)=NNC(=O)CCCCCCC(=O)NN=C(C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-19(21-11-15-23(33-3)16-12-21)27-29-25(31)9-7-5-6-8-10-26(32)30-28-20(2)22-13-17-24(34-4)18-14-22/h11-18H,5-10H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | VSUNNGRWERHGCJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|