C25H25N3O3 — CID 6052542
N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide (PubChem CID 6052542) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide.
| Compound Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide |
|---|---|
| PubChem CID | 6052542 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(Z)-1-(4-methoxyphenyl)ethylideneamino]-N',N'-diphenylbutanediamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)CCC(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-19(20-13-15-23(31-2)16-14-20)26-27-24(29)17-18-25(30)28(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16H,17-18H2,1-2H3,(H,27,29)/b26-19- |
| InChIKey | MJUVELXPVPZYFW-XHPQRKPJSA-N |
| XLogP | 4.68 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|