C22H21N3O2S — CID 3886917
N',N'-diphenyl-N-(1-thiophen-2-ylethylideneamino)butanediamide (PubChem CID 3886917) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N',N'-diphenyl-N-(1-thiophen-2-ylethylideneamino)butanediamide.
| Compound Name | N',N'-diphenyl-N-(1-thiophen-2-ylethylideneamino)butanediamide |
|---|---|
| PubChem CID | 3886917 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N',N'-diphenyl-N-(1-thiophen-2-ylethylideneamino)butanediamide |
| SMILES | CC(=NNC(=O)CCC(=O)N(c1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C22H21N3O2S/c1-17(20-13-8-16-28-20)23-24-21(26)14-15-22(27)25(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-13,16H,14-15H2,1H3,(H,24,26) |
| InChIKey | JXOOWBHYYIPNNQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|