C19H24N4O2S2 — CID 19685885
N,N'-bis[(E)-1-thiophen-2-ylethylideneamino]heptanediamide (PubChem CID 19685885) has the molecular formula C19H24N4O2S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N,N'-bis[(E)-1-thiophen-2-ylethylideneamino]heptanediamide.
| Compound Name | N,N'-bis[(E)-1-thiophen-2-ylethylideneamino]heptanediamide |
|---|---|
| PubChem CID | 19685885 |
| Molecular Formula | C19H24N4O2S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N,N'-bis[(E)-1-thiophen-2-ylethylideneamino]heptanediamide |
| SMILES | C/C(=N\NC(=O)CCCCCC(=O)N/N=C(\C)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C19H24N4O2S2/c1-14(16-8-6-12-26-16)20-22-18(24)10-4-3-5-11-19(25)23-21-15(2)17-9-7-13-27-17/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,22,24)(H,23,25)/b20-14+,21-15+ |
| InChIKey | OBGCZCHKJSSIBJ-OZNQKUEASA-N |
| XLogP | 4.14 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|