C20H25N3O2S — CID 5059756
N-[4-[N-(heptanoylamino)-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide (PubChem CID 5059756) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[4-[N-(heptanoylamino)-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[N-(heptanoylamino)-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5059756 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[4-[N-(heptanoylamino)-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CCCCCCC(=O)NN=C(C)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-3-4-5-6-9-19(24)23-22-15(2)16-10-12-17(13-11-16)21-20(25)18-8-7-14-26-18/h7-8,10-14H,3-6,9H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | YKLZSQKFFTUGMQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|