C18H21N3O2S — CID 4653766
N-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]phenyl]thiophene-2-carboxamide (PubChem CID 4653766) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4653766 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[4-[C-methyl-N-(3-methylbutanoylamino)carbonimidoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)CC(C)C)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H21N3O2S/c1-12(2)11-17(22)21-20-13(3)14-6-8-15(9-7-14)19-18(23)16-5-4-10-24-16/h4-10,12H,11H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | XWOJEVDPJBZGKU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|