C20H16BrN3O2S — CID 3558400
N-[4-[N-[(4-bromobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide (PubChem CID 3558400) has the molecular formula C20H16BrN3O2S and a molecular weight of 442.34 g/mol. Its IUPAC name is N-[4-[N-[(4-bromobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[N-[(4-bromobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3558400 |
| Molecular Formula | C20H16BrN3O2S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | N-[4-[N-[(4-bromobenzoyl)amino]-C-methylcarbonimidoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(Br)cc1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H16BrN3O2S/c1-13(23-24-19(25)15-4-8-16(21)9-5-15)14-6-10-17(11-7-14)22-20(26)18-3-2-12-27-18/h2-12H,1H3,(H,22,26)(H,24,25) |
| InChIKey | XJSZRABNLCHUCC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|