C23H23N3O3S — CID 33027717
N-[3-[[4-(3-methylbutanoylamino)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 33027717) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[3-[[4-(3-methylbutanoylamino)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[4-(3-methylbutanoylamino)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 33027717 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[3-[[4-(3-methylbutanoylamino)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)c2cccc(NC(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-15(2)13-21(27)24-17-8-10-18(11-9-17)25-22(28)16-5-3-6-19(14-16)26-23(29)20-7-4-12-30-20/h3-12,14-15H,13H2,1-2H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | XOMSXVUBNGLZGK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |