C22H23N3O4S2 — CID 33026888
N-[4-(3-methylbutanoylamino)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 33026888) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-(3-methylbutanoylamino)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[4-(3-methylbutanoylamino)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 33026888 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-[4-(3-methylbutanoylamino)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-15(2)14-20(26)23-17-9-11-18(12-10-17)24-22(27)16-5-7-19(8-6-16)25-31(28,29)21-4-3-13-30-21/h3-13,15,25H,14H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | CZERXCWSCYVPFH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |