C19H15F3N2O3S2 — CID 55490725
N-[4-methyl-3-(trifluoromethyl)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55490725) has the molecular formula C19H15F3N2O3S2 and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55490725 |
| Molecular Formula | C19H15F3N2O3S2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NS(=O)(=O)c3cccs3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H15F3N2O3S2/c1-12-4-7-15(11-16(12)19(20,21)22)23-18(25)13-5-8-14(9-6-13)24-29(26,27)17-3-2-10-28-17/h2-11,24H,1H3,(H,23,25) |
| InChIKey | DZIJSRHOHYHARN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |