C12H7F6NO2S2 — CID 2474123
N-[3,4-bis(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 2474123) has the molecular formula C12H7F6NO2S2 and a molecular weight of 375.32 g/mol. Its IUPAC name is N-[3,4-bis(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3,4-bis(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2474123 |
| Molecular Formula | C12H7F6NO2S2 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | N-[3,4-bis(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C12H7F6NO2S2/c13-11(14,15)8-4-3-7(6-9(8)12(16,17)18)19-23(20,21)10-2-1-5-22-10/h1-6,19H |
| InChIKey | VGKJSDFOUDFDNV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |