C11H9NO4S2 — CID 651313
N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide (PubChem CID 651313) has the molecular formula C11H9NO4S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 651313 |
| Molecular Formula | C11H9NO4S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1cccs1 |
| InChI | InChI=1S/C11H9NO4S2/c13-18(14,11-2-1-5-17-11)12-8-3-4-9-10(6-8)16-7-15-9/h1-6,12H,7H2 |
| InChIKey | AMCBPKMBXSZUQK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |