C12H12N2O4S2 — CID 43332813
5-(aminomethyl)-N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide (PubChem CID 43332813) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43332813 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5-(aminomethyl)-N-(1,3-benzodioxol-5-yl)thiophene-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C12H12N2O4S2/c13-6-9-2-4-12(19-9)20(15,16)14-8-1-3-10-11(5-8)18-7-17-10/h1-5,14H,6-7,13H2 |
| InChIKey | SDVORGNPBNAAPO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |